C27H45N3O2S — CID 134368753
tert-butyl (3S)-3-methyl-4-[1-(tripropyl-λ4-sulfanyl)indol-5-yl]piperazine-1-carboxylate (PubChem CID 134368753) has the molecular formula C27H45N3O2S and a molecular weight of 475.74 g/mol. Its IUPAC name is tert-butyl (3S)-3-methyl-4-[1-(tripropyl-λ4-sulfanyl)indol-5-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-methyl-4-[1-(tripropyl-λ4-sulfanyl)indol-5-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 134368753 |
| Molecular Formula | C27H45N3O2S |
| Molecular Weight | 475.74 g/mol |
| Exact Mass | 475.32 |
| IUPAC Name | tert-butyl (3S)-3-methyl-4-[1-(tripropyl-λ4-sulfanyl)indol-5-yl]piperazine-1-carboxylate |
| SMILES | CCCS(CCC)(CCC)n1ccc2cc(N3CCN(C(=O)OC(C)(C)C)C[C@@H]3C)ccc21 |
| InChI | InChI=1S/C27H45N3O2S/c1-8-17-33(18-9-2,19-10-3)30-14-13-23-20-24(11-12-25(23)30)29-16-15-28(21-22(29)4)26(31)32-27(5,6)7/h11-14,20,22H,8-10,15-19,21H2,1-7H3/t22-/m0/s1 |
| InChIKey | KEFXFVJIOWNOSU-QFIPXVFZSA-N |
| XLogP | 6.88 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.74 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |