C31H32F7N3O5S — CID 134374635
4-[[3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-[3-(1-methylpyrazol-4-yl)phenyl]sulfonylpyrrolidin-1-yl]-hydroxymethyl]cyclohexane-1-carboxylic acid (PubChem CID 134374635) has the molecular formula C31H32F7N3O5S and a molecular weight of 691.67 g/mol. Its IUPAC name is 4-[[3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-[3-(1-methylpyrazol-4-yl)phenyl]sulfonylpyrrolidin-1-yl]-hydroxymethyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-[3-(1-methylpyrazol-4-yl)phenyl]sulfonylpyrrolidin-1-yl]-hydroxymethyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 134374635 |
| Molecular Formula | C31H32F7N3O5S |
| Molecular Weight | 691.67 g/mol |
| Exact Mass | 691.20 |
| IUPAC Name | 4-[[3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-[3-(1-methylpyrazol-4-yl)phenyl]sulfonylpyrrolidin-1-yl]-hydroxymethyl]cyclohexane-1-carboxylic acid |
| SMILES | Cn1cc(-c2cccc(S(=O)(=O)C3(c4ccc(C(F)(C(F)(F)F)C(F)(F)F)cc4)CCN(C(O)C4CCC(C(=O)O)CC4)C3)c2)cn1 |
| InChI | InChI=1S/C31H32F7N3O5S/c1-40-17-22(16-39-40)21-3-2-4-25(15-21)47(45,46)28(13-14-41(18-28)26(42)19-5-7-20(8-6-19)27(43)44)23-9-11-24(12-10-23)29(32,30(33,34)35)31(36,37)38/h2-4,9-12,15-17,19-20,26,42H,5-8,13-14,18H2,1H3,(H,43,44) |
| InChIKey | OEBDNTFGOJCLPW-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.67 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |