C13H10ClFN2S — CID 134377370
(4S)-4-(2-chloro-6-fluorophenyl)-6,8-diazatricyclo[4.3.0.02,4]non-1(9)-ene-7-thione (PubChem CID 134377370) has the molecular formula C13H10ClFN2S and a molecular weight of 280.75 g/mol. Its IUPAC name is (4S)-4-(2-chloro-6-fluorophenyl)-6,8-diazatricyclo[4.3.0.02,4]non-1(9)-ene-7-thione.
| Compound Name | (4S)-4-(2-chloro-6-fluorophenyl)-6,8-diazatricyclo[4.3.0.02,4]non-1(9)-ene-7-thione |
|---|---|
| PubChem CID | 134377370 |
| Molecular Formula | C13H10ClFN2S |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | (4S)-4-(2-chloro-6-fluorophenyl)-6,8-diazatricyclo[4.3.0.02,4]non-1(9)-ene-7-thione |
| SMILES | Fc1cccc(Cl)c1[C@]12CC1c1c[nH]c(=S)n1C2 |
| InChI | InChI=1S/C13H10ClFN2S/c14-8-2-1-3-9(15)11(8)13-4-7(13)10-5-16-12(18)17(10)6-13/h1-3,5,7H,4,6H2,(H,16,18)/t7?,13-/m0/s1 |
| InChIKey | JKHLATWVFPYIIG-GRSHUZJTSA-N |
| XLogP | 3.78 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|