C13H11F3N2S — CID 134376955
7-[(2,3,6-trifluorophenyl)methyl]-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione (PubChem CID 134376955) has the molecular formula C13H11F3N2S and a molecular weight of 284.31 g/mol. Its IUPAC name is 7-[(2,3,6-trifluorophenyl)methyl]-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione.
| Compound Name | 7-[(2,3,6-trifluorophenyl)methyl]-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione |
|---|---|
| PubChem CID | 134376955 |
| Molecular Formula | C13H11F3N2S |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 7-[(2,3,6-trifluorophenyl)methyl]-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione |
| SMILES | Fc1ccc(F)c(CC2CCn3c2c[nH]c3=S)c1F |
| InChI | InChI=1S/C13H11F3N2S/c14-9-1-2-10(15)12(16)8(9)5-7-3-4-18-11(7)6-17-13(18)19/h1-2,6-7H,3-5H2,(H,17,19) |
| InChIKey | FJIUMCRHZAKUMZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|