C8H11ClS — CID 134377420
5-chloro-6-methyl-2-methylsulfanylcyclohexa-1,3-diene (PubChem CID 134377420) has the molecular formula C8H11ClS and a molecular weight of 174.70 g/mol. Its IUPAC name is 5-chloro-6-methyl-2-methylsulfanylcyclohexa-1,3-diene.
| Compound Name | 5-chloro-6-methyl-2-methylsulfanylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 134377420 |
| Molecular Formula | C8H11ClS |
| Molecular Weight | 174.70 g/mol |
| Exact Mass | 174.03 |
| IUPAC Name | 5-chloro-6-methyl-2-methylsulfanylcyclohexa-1,3-diene |
| SMILES | CSC1=CC(C)C(Cl)C=C1 |
| InChI | InChI=1S/C8H11ClS/c1-6-5-7(10-2)3-4-8(6)9/h3-6,8H,1-2H3 |
| InChIKey | PTTOXFFOOALMIJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.70 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|