C9H15ClS — CID 134377589
(2Z,4E)-1-chloro-6-methyl-4-methylsulfanylhepta-2,4-diene (PubChem CID 134377589) has the molecular formula C9H15ClS and a molecular weight of 190.74 g/mol. Its IUPAC name is (2Z,4E)-1-chloro-6-methyl-4-methylsulfanylhepta-2,4-diene.
| Compound Name | (2Z,4E)-1-chloro-6-methyl-4-methylsulfanylhepta-2,4-diene |
|---|---|
| PubChem CID | 134377589 |
| Molecular Formula | C9H15ClS |
| Molecular Weight | 190.74 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | (2Z,4E)-1-chloro-6-methyl-4-methylsulfanylhepta-2,4-diene |
| SMILES | CSC(/C=C\CCl)=C/C(C)C |
| InChI | InChI=1S/C9H15ClS/c1-8(2)7-9(11-3)5-4-6-10/h4-5,7-8H,6H2,1-3H3/b5-4-,9-7+ |
| InChIKey | BDQGUPOXPXVCJZ-XEQCUQEESA-N |
| XLogP | 3.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.74 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|