C8H9ClS — CID 143284632
7-chloro-2-methylsulfanylcyclohepta-1,3,5-triene (PubChem CID 143284632) has the molecular formula C8H9ClS and a molecular weight of 172.68 g/mol. Its IUPAC name is 7-chloro-2-methylsulfanylcyclohepta-1,3,5-triene.
| Compound Name | 7-chloro-2-methylsulfanylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 143284632 |
| Molecular Formula | C8H9ClS |
| Molecular Weight | 172.68 g/mol |
| Exact Mass | 172.01 |
| IUPAC Name | 7-chloro-2-methylsulfanylcyclohepta-1,3,5-triene |
| SMILES | CSC1=CC(Cl)C=CC=C1 |
| InChI | InChI=1S/C8H9ClS/c1-10-8-5-3-2-4-7(9)6-8/h2-7H,1H3 |
| InChIKey | BAXIAAPFDHHZNN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.68 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|