C30H37FN2O2 — CID 134377596
(6R)-6-[(1S,2S)-2-ethyl-3-(5-fluoro-3-pyridinyl)-2-methylcyclopent-3-en-1-yl]-N-[1-(hydroxymethyl)cyclopentyl]-5,6,7,8-tetrahydronaphthalene-2-carboxamide (PubChem CID 134377596) has the molecular formula C30H37FN2O2 and a molecular weight of 476.64 g/mol. Its IUPAC name is (6R)-6-[(1S,2S)-2-ethyl-3-(5-fluoro-3-pyridinyl)-2-methylcyclopent-3-en-1-yl]-N-[1-(hydroxymethyl)cyclopentyl]-5,6,7,8-tetrahydronaphthalene-2-carboxamide.
| Compound Name | (6R)-6-[(1S,2S)-2-ethyl-3-(5-fluoro-3-pyridinyl)-2-methylcyclopent-3-en-1-yl]-N-[1-(hydroxymethyl)cyclopentyl]-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 134377596 |
| Molecular Formula | C30H37FN2O2 |
| Molecular Weight | 476.64 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | (6R)-6-[(1S,2S)-2-ethyl-3-(5-fluoro-3-pyridinyl)-2-methylcyclopent-3-en-1-yl]-N-[1-(hydroxymethyl)cyclopentyl]-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
| SMILES | CC[C@]1(C)C(c2cncc(F)c2)=CC[C@H]1[C@@H]1CCc2cc(C(=O)NC3(CO)CCCC3)ccc2C1 |
| InChI | InChI=1S/C30H37FN2O2/c1-3-29(2)26(10-11-27(29)24-16-25(31)18-32-17-24)22-8-6-21-15-23(9-7-20(21)14-22)28(35)33-30(19-34)12-4-5-13-30/h7,9,11,15-18,22,26,34H,3-6,8,10,12-14,19H2,1-2H3,(H,33,35)/t22-,26+,29+/m1/s1 |
| InChIKey | YKIQVLALUOXCOU-DVTKYRPYSA-N |
| XLogP | 5.88 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.64 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |