C15H21NO2S — CID 134379961
1-(4-methylphenyl)sulfonyl-4-propan-2-yl-3,6-dihydro-2H-pyridine (PubChem CID 134379961) has the molecular formula C15H21NO2S and a molecular weight of 279.41 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-4-propan-2-yl-3,6-dihydro-2H-pyridine.
| Compound Name | 1-(4-methylphenyl)sulfonyl-4-propan-2-yl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 134379961 |
| Molecular Formula | C15H21NO2S |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-4-propan-2-yl-3,6-dihydro-2H-pyridine |
| SMILES | Cc1ccc(S(=O)(=O)N2CC=C(C(C)C)CC2)cc1 |
| InChI | InChI=1S/C15H21NO2S/c1-12(2)14-8-10-16(11-9-14)19(17,18)15-6-4-13(3)5-7-15/h4-8,12H,9-11H2,1-3H3 |
| InChIKey | XVQMRDSOPPAJMA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|