C26H25NO4 — CID 134388674
(E)-3-[3-carbamoyl-4-[4-methoxy-3-(5-tricyclo[3.3.1.02,7]non-2-enyl)phenyl]phenyl]prop-2-enoic acid (PubChem CID 134388674) has the molecular formula C26H25NO4 and a molecular weight of 415.49 g/mol. Its IUPAC name is (E)-3-[3-carbamoyl-4-[4-methoxy-3-(5-tricyclo[3.3.1.02,7]non-2-enyl)phenyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-carbamoyl-4-[4-methoxy-3-(5-tricyclo[3.3.1.02,7]non-2-enyl)phenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 134388674 |
| Molecular Formula | C26H25NO4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | (E)-3-[3-carbamoyl-4-[4-methoxy-3-(5-tricyclo[3.3.1.02,7]non-2-enyl)phenyl]phenyl]prop-2-enoic acid |
| SMILES | COc1ccc(-c2ccc(/C=C/C(=O)O)cc2C(N)=O)cc1C12CC=C3C(CC3C1)C2 |
| InChI | InChI=1S/C26H25NO4/c1-31-23-6-4-16(12-22(23)26-9-8-19-17(13-26)11-18(19)14-26)20-5-2-15(3-7-24(28)29)10-21(20)25(27)30/h2-8,10,12,17-18H,9,11,13-14H2,1H3,(H2,27,30)(H,28,29)/b7-3+ |
| InChIKey | DGUFPPFELHLUOH-XVNBXDOJSA-N |
| XLogP | 4.56 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|