C21H19F3N2O6 — CID 134391654
2-acetyl-2-[[4-[2-methyl-4-(methylamino)phenyl]-3-(trifluoromethyl)phenyl]carbamoyl]propanedioic acid (PubChem CID 134391654) has the molecular formula C21H19F3N2O6 and a molecular weight of 452.39 g/mol. Its IUPAC name is 2-acetyl-2-[[4-[2-methyl-4-(methylamino)phenyl]-3-(trifluoromethyl)phenyl]carbamoyl]propanedioic acid.
| Compound Name | 2-acetyl-2-[[4-[2-methyl-4-(methylamino)phenyl]-3-(trifluoromethyl)phenyl]carbamoyl]propanedioic acid |
|---|---|
| PubChem CID | 134391654 |
| Molecular Formula | C21H19F3N2O6 |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 2-acetyl-2-[[4-[2-methyl-4-(methylamino)phenyl]-3-(trifluoromethyl)phenyl]carbamoyl]propanedioic acid |
| SMILES | CNc1ccc(-c2ccc(NC(=O)C(C(C)=O)(C(=O)O)C(=O)O)cc2C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C21H19F3N2O6/c1-10-8-12(25-3)4-6-14(10)15-7-5-13(9-16(15)21(22,23)24)26-17(28)20(11(2)27,18(29)30)19(31)32/h4-9,25H,1-3H3,(H,26,28)(H,29,30)(H,31,32) |
| InChIKey | MVFOYRGGLDVHJW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|