C22H21F3N6O3 — CID 134402527
4-(3-methyldiazirin-3-yl)-N-[2-[2-[[4-[3-(trifluoromethyl)diazirin-3-yl]benzoyl]amino]ethoxy]ethyl]benzamide (PubChem CID 134402527) has the molecular formula C22H21F3N6O3 and a molecular weight of 474.44 g/mol. Its IUPAC name is 4-(3-methyldiazirin-3-yl)-N-[2-[2-[[4-[3-(trifluoromethyl)diazirin-3-yl]benzoyl]amino]ethoxy]ethyl]benzamide.
| Compound Name | 4-(3-methyldiazirin-3-yl)-N-[2-[2-[[4-[3-(trifluoromethyl)diazirin-3-yl]benzoyl]amino]ethoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 134402527 |
| Molecular Formula | C22H21F3N6O3 |
| Molecular Weight | 474.44 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 4-(3-methyldiazirin-3-yl)-N-[2-[2-[[4-[3-(trifluoromethyl)diazirin-3-yl]benzoyl]amino]ethoxy]ethyl]benzamide |
| SMILES | CC1(c2ccc(C(=O)NCCOCCNC(=O)c3ccc(C4(C(F)(F)F)N=N4)cc3)cc2)N=N1 |
| InChI | InChI=1S/C22H21F3N6O3/c1-20(28-29-20)16-6-2-14(3-7-16)18(32)26-10-12-34-13-11-27-19(33)15-4-8-17(9-5-15)21(30-31-21)22(23,24)25/h2-9H,10-13H2,1H3,(H,26,32)(H,27,33) |
| InChIKey | UEFKSAWXJGOKAD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 116.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|