C15H18F3N3O — CID 134402528
N-(3,3-dimethylbutyl)-4-[3-(trifluoromethyl)diazirin-3-yl]benzamide (PubChem CID 134402528) has the molecular formula C15H18F3N3O and a molecular weight of 313.32 g/mol. Its IUPAC name is N-(3,3-dimethylbutyl)-4-[3-(trifluoromethyl)diazirin-3-yl]benzamide.
| Compound Name | N-(3,3-dimethylbutyl)-4-[3-(trifluoromethyl)diazirin-3-yl]benzamide |
|---|---|
| PubChem CID | 134402528 |
| Molecular Formula | C15H18F3N3O |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | N-(3,3-dimethylbutyl)-4-[3-(trifluoromethyl)diazirin-3-yl]benzamide |
| SMILES | CC(C)(C)CCNC(=O)c1ccc(C2(C(F)(F)F)N=N2)cc1 |
| InChI | InChI=1S/C15H18F3N3O/c1-13(2,3)8-9-19-12(22)10-4-6-11(7-5-10)14(20-21-14)15(16,17)18/h4-7H,8-9H2,1-3H3,(H,19,22) |
| InChIKey | IDQFPVIMGFIDPN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |