C16H17F6N3O4 — CID 11683377
2,2,2-trifluoro-N-[2-[2-[2-[3-[3-(trifluoromethyl)diazirin-3-yl]phenoxy]ethoxy]ethoxy]ethyl]acetamide (PubChem CID 11683377) has the molecular formula C16H17F6N3O4 and a molecular weight of 429.32 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-[2-[2-[3-[3-(trifluoromethyl)diazirin-3-yl]phenoxy]ethoxy]ethoxy]ethyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2-[2-[2-[3-[3-(trifluoromethyl)diazirin-3-yl]phenoxy]ethoxy]ethoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 11683377 |
| Molecular Formula | C16H17F6N3O4 |
| Molecular Weight | 429.32 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-[2-[2-[3-[3-(trifluoromethyl)diazirin-3-yl]phenoxy]ethoxy]ethoxy]ethyl]acetamide |
| SMILES | O=C(NCCOCCOCCOc1cccc(C2(C(F)(F)F)N=N2)c1)C(F)(F)F |
| InChI | InChI=1S/C16H17F6N3O4/c17-15(18,19)13(26)23-4-5-27-6-7-28-8-9-29-12-3-1-2-11(10-12)14(24-25-14)16(20,21)22/h1-3,10H,4-9H2,(H,23,26) |
| InChIKey | IHULSHPLVMHDGQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|