C14H10Cl2INO4 — CID 134402841
2-[2-(2,6-dichloro-4-hydroxyanilino)-5-iodooxyphenyl]acetic acid (PubChem CID 134402841) has the molecular formula C14H10Cl2INO4 and a molecular weight of 454.05 g/mol. Its IUPAC name is 2-[2-(2,6-dichloro-4-hydroxyanilino)-5-iodooxyphenyl]acetic acid.
| Compound Name | 2-[2-(2,6-dichloro-4-hydroxyanilino)-5-iodooxyphenyl]acetic acid |
|---|---|
| PubChem CID | 134402841 |
| Molecular Formula | C14H10Cl2INO4 |
| Molecular Weight | 454.05 g/mol |
| Exact Mass | 452.90 |
| IUPAC Name | 2-[2-(2,6-dichloro-4-hydroxyanilino)-5-iodooxyphenyl]acetic acid |
| SMILES | O=C(O)Cc1cc(OI)ccc1Nc1c(Cl)cc(O)cc1Cl |
| InChI | InChI=1S/C14H10Cl2INO4/c15-10-5-8(19)6-11(16)14(10)18-12-2-1-9(22-17)3-7(12)4-13(20)21/h1-3,5-6,18-19H,4H2,(H,20,21) |
| InChIKey | UJHJFPVCCRQAFB-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.05 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|