C20H19Cl2NO9 — CID 102050943
(2S,3S,4S,5R,6S)-6-[2-[2-(2,6-dichloro-4-hydroxyanilino)phenyl]acetyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 102050943) has the molecular formula C20H19Cl2NO9 and a molecular weight of 488.28 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-6-[2-[2-(2,6-dichloro-4-hydroxyanilino)phenyl]acetyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6S)-6-[2-[2-(2,6-dichloro-4-hydroxyanilino)phenyl]acetyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 102050943 |
| Molecular Formula | C20H19Cl2NO9 |
| Molecular Weight | 488.28 g/mol |
| Exact Mass | 487.04 |
| IUPAC Name | (2S,3S,4S,5R,6S)-6-[2-[2-(2,6-dichloro-4-hydroxyanilino)phenyl]acetyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | O=C(Cc1ccccc1Nc1c(Cl)cc(O)cc1Cl)O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C20H19Cl2NO9/c21-10-6-9(24)7-11(22)14(10)23-12-4-2-1-3-8(12)5-13(25)31-20-17(28)15(26)16(27)18(32-20)19(29)30/h1-4,6-7,15-18,20,23-24,26-28H,5H2,(H,29,30)/t15-,16-,17+,18-,20+/m0/s1 |
| InChIKey | LACPFNRKLYVMOM-HBWRTXEVSA-N |
| XLogP | 1.42 |
| TPSA | 165.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.28 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|