C20H19Cl2NO8 — CID 46781256
(3R,4R,5R,6R)-6-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 46781256) has the molecular formula C20H19Cl2NO8 and a molecular weight of 472.28 g/mol. Its IUPAC name is (3R,4R,5R,6R)-6-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (3R,4R,5R,6R)-6-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 46781256 |
| Molecular Formula | C20H19Cl2NO8 |
| Molecular Weight | 472.28 g/mol |
| Exact Mass | 471.05 |
| IUPAC Name | (3R,4R,5R,6R)-6-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | O=C(Cc1ccccc1Nc1c(Cl)cccc1Cl)O[C@H]1OC(C(=O)O)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H19Cl2NO8/c21-10-5-3-6-11(22)14(10)23-12-7-2-1-4-9(12)8-13(24)30-20-17(27)15(25)16(26)18(31-20)19(28)29/h1-7,15-18,20,23,25-27H,8H2,(H,28,29)/t15-,16-,17-,18?,20+/m1/s1 |
| InChIKey | JXIKYYSIYCILNG-AZYHFFFZSA-N |
| XLogP | 1.71 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |