C9H20N2O3S2 — CID 134408871
(2R)-3-(disulfanyl)-N-(2-hydroxypropyl)-2-(3-hydroxypropylamino)propanamide (PubChem CID 134408871) has the molecular formula C9H20N2O3S2 and a molecular weight of 268.40 g/mol. Its IUPAC name is (2R)-3-(disulfanyl)-N-(2-hydroxypropyl)-2-(3-hydroxypropylamino)propanamide.
| Compound Name | (2R)-3-(disulfanyl)-N-(2-hydroxypropyl)-2-(3-hydroxypropylamino)propanamide |
|---|---|
| PubChem CID | 134408871 |
| Molecular Formula | C9H20N2O3S2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | (2R)-3-(disulfanyl)-N-(2-hydroxypropyl)-2-(3-hydroxypropylamino)propanamide |
| SMILES | CC(O)CNC(=O)[C@H](CSS)NCCCO |
| InChI | InChI=1S/C9H20N2O3S2/c1-7(13)5-11-9(14)8(6-16-15)10-3-2-4-12/h7-8,10,12-13,15H,2-6H2,1H3,(H,11,14)/t7?,8-/m0/s1 |
| InChIKey | GBMVRCYVXDVAON-MQWKRIRWSA-N |
| XLogP | -0.60 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|