C33H38F6OS — CID 134408932
2-[4-[4-[[3,5-difluoro-4-(trifluoromethyl)phenyl]methoxy]cyclohexyl]cyclohexyl]-3-fluoro-6-pentyl-1-benzothiophene (PubChem CID 134408932) has the molecular formula C33H38F6OS and a molecular weight of 596.72 g/mol. Its IUPAC name is 2-[4-[4-[[3,5-difluoro-4-(trifluoromethyl)phenyl]methoxy]cyclohexyl]cyclohexyl]-3-fluoro-6-pentyl-1-benzothiophene.
| Compound Name | 2-[4-[4-[[3,5-difluoro-4-(trifluoromethyl)phenyl]methoxy]cyclohexyl]cyclohexyl]-3-fluoro-6-pentyl-1-benzothiophene |
|---|---|
| PubChem CID | 134408932 |
| Molecular Formula | C33H38F6OS |
| Molecular Weight | 596.72 g/mol |
| Exact Mass | 596.25 |
| IUPAC Name | 2-[4-[4-[[3,5-difluoro-4-(trifluoromethyl)phenyl]methoxy]cyclohexyl]cyclohexyl]-3-fluoro-6-pentyl-1-benzothiophene |
| SMILES | CCCCCc1ccc2c(F)c(C3CCC(C4CCC(OCc5cc(F)c(C(F)(F)F)c(F)c5)CC4)CC3)sc2c1 |
| InChI | InChI=1S/C33H38F6OS/c1-2-3-4-5-20-6-15-26-29(18-20)41-32(31(26)36)24-9-7-22(8-10-24)23-11-13-25(14-12-23)40-19-21-16-27(34)30(28(35)17-21)33(37,38)39/h6,15-18,22-25H,2-5,7-14,19H2,1H3 |
| InChIKey | LWJHPLDVJAPCBF-UHFFFAOYSA-N |
| XLogP | 11.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.72 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|