C20H16F6N2O2 — CID 134412219
(3S,4S)-1-(2,2-difluoroethyl)-N-(2-fluorophenyl)-2-oxo-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide (PubChem CID 134412219) has the molecular formula C20H16F6N2O2 and a molecular weight of 430.35 g/mol. Its IUPAC name is (3S,4S)-1-(2,2-difluoroethyl)-N-(2-fluorophenyl)-2-oxo-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | (3S,4S)-1-(2,2-difluoroethyl)-N-(2-fluorophenyl)-2-oxo-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 134412219 |
| Molecular Formula | C20H16F6N2O2 |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | (3S,4S)-1-(2,2-difluoroethyl)-N-(2-fluorophenyl)-2-oxo-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1F)[C@H]1C(=O)N(CC(F)F)C[C@@H]1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H16F6N2O2/c21-14-6-1-2-7-15(14)27-18(29)17-13(9-28(19(17)30)10-16(22)23)11-4-3-5-12(8-11)20(24,25)26/h1-8,13,16-17H,9-10H2,(H,27,29)/t13-,17+/m1/s1 |
| InChIKey | YNQXLNJBTAZOHF-DYVFJYSZSA-N |
| XLogP | 4.29 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|