C19H15BrF4N2O2 — CID 176646736
3-bromo-N-(2-fluorophenyl)-1-methyl-2-oxo-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide (PubChem CID 176646736) has the molecular formula C19H15BrF4N2O2 and a molecular weight of 459.24 g/mol. Its IUPAC name is 3-bromo-N-(2-fluorophenyl)-1-methyl-2-oxo-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | 3-bromo-N-(2-fluorophenyl)-1-methyl-2-oxo-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 176646736 |
| Molecular Formula | C19H15BrF4N2O2 |
| Molecular Weight | 459.24 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | 3-bromo-N-(2-fluorophenyl)-1-methyl-2-oxo-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
| SMILES | CN1CC(c2cccc(C(F)(F)F)c2)C(Br)(C(=O)Nc2ccccc2F)C1=O |
| InChI | InChI=1S/C19H15BrF4N2O2/c1-26-10-13(11-5-4-6-12(9-11)19(22,23)24)18(20,17(26)28)16(27)25-15-8-3-2-7-14(15)21/h2-9,13H,10H2,1H3,(H,25,27) |
| InChIKey | IREJEULIFNIFFY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.24 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|