C10H7F4NO2 — CID 87995082
(2R)-N-(2-fluorophenyl)-2-(trifluoromethyl)oxirane-2-carboxamide (PubChem CID 87995082) has the molecular formula C10H7F4NO2 and a molecular weight of 249.16 g/mol. Its IUPAC name is (2R)-N-(2-fluorophenyl)-2-(trifluoromethyl)oxirane-2-carboxamide.
| Compound Name | (2R)-N-(2-fluorophenyl)-2-(trifluoromethyl)oxirane-2-carboxamide |
|---|---|
| PubChem CID | 87995082 |
| Molecular Formula | C10H7F4NO2 |
| Molecular Weight | 249.16 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | (2R)-N-(2-fluorophenyl)-2-(trifluoromethyl)oxirane-2-carboxamide |
| SMILES | O=C(Nc1ccccc1F)[C@@]1(C(F)(F)F)CO1 |
| InChI | InChI=1S/C10H7F4NO2/c11-6-3-1-2-4-7(6)15-8(16)9(5-17-9)10(12,13)14/h1-4H,5H2,(H,15,16)/t9-/m1/s1 |
| InChIKey | ICNZFBCSCUBOCF-SECBINFHSA-N |
| XLogP | 2.10 |
| TPSA | 41.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.16 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|