C18H15F4N3O3 — CID 134412691
(3S,4S)-N-(2-fluoro-3-pyridinyl)-1-methoxy-2-oxo-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide (PubChem CID 134412691) has the molecular formula C18H15F4N3O3 and a molecular weight of 397.33 g/mol. Its IUPAC name is (3S,4S)-N-(2-fluoro-3-pyridinyl)-1-methoxy-2-oxo-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | (3S,4S)-N-(2-fluoro-3-pyridinyl)-1-methoxy-2-oxo-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 134412691 |
| Molecular Formula | C18H15F4N3O3 |
| Molecular Weight | 397.33 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | (3S,4S)-N-(2-fluoro-3-pyridinyl)-1-methoxy-2-oxo-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
| SMILES | CON1C[C@H](c2ccc(C(F)(F)F)cc2)[C@@H](C(=O)Nc2cccnc2F)C1=O |
| InChI | InChI=1S/C18H15F4N3O3/c1-28-25-9-12(10-4-6-11(7-5-10)18(20,21)22)14(17(25)27)16(26)24-13-3-2-8-23-15(13)19/h2-8,12,14H,9H2,1H3,(H,24,26)/t12-,14+/m1/s1 |
| InChIKey | DSDVXMALBFSBFX-OCCSQVGLSA-N |
| XLogP | 2.98 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|