C9H15Cl2N — CID 134421953
(1S)-6,6-dichloro-3-methyl-2-propan-2-yl-3-azabicyclo[3.1.0]hexane (PubChem CID 134421953) has the molecular formula C9H15Cl2N and a molecular weight of 208.13 g/mol. Its IUPAC name is (1S)-6,6-dichloro-3-methyl-2-propan-2-yl-3-azabicyclo[3.1.0]hexane.
| Compound Name | (1S)-6,6-dichloro-3-methyl-2-propan-2-yl-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 134421953 |
| Molecular Formula | C9H15Cl2N |
| Molecular Weight | 208.13 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | (1S)-6,6-dichloro-3-methyl-2-propan-2-yl-3-azabicyclo[3.1.0]hexane |
| SMILES | CC(C)C1[C@@H]2C(CN1C)C2(Cl)Cl |
| InChI | InChI=1S/C9H15Cl2N/c1-5(2)8-7-6(4-12(8)3)9(7,10)11/h5-8H,4H2,1-3H3/t6?,7-,8?/m0/s1 |
| InChIKey | KJCAFGVXOMUDNV-WTIBDHCWSA-N |
| XLogP | 2.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.13 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|