C8H15Cl2N3O — CID 90992702
2-(2,4-dichloro-1,3-dimethyl-1,3-diazinan-5-yl)oxiran-2-amine (PubChem CID 90992702) has the molecular formula C8H15Cl2N3O and a molecular weight of 240.13 g/mol. Its IUPAC name is 2-(2,4-dichloro-1,3-dimethyl-1,3-diazinan-5-yl)oxiran-2-amine.
| Compound Name | 2-(2,4-dichloro-1,3-dimethyl-1,3-diazinan-5-yl)oxiran-2-amine |
|---|---|
| PubChem CID | 90992702 |
| Molecular Formula | C8H15Cl2N3O |
| Molecular Weight | 240.13 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 2-(2,4-dichloro-1,3-dimethyl-1,3-diazinan-5-yl)oxiran-2-amine |
| SMILES | CN1CC(C2(N)CO2)C(Cl)N(C)C1Cl |
| InChI | InChI=1S/C8H15Cl2N3O/c1-12-3-5(8(11)4-14-8)6(9)13(2)7(12)10/h5-7H,3-4,11H2,1-2H3 |
| InChIKey | DVIOCWXTEAWMEQ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 45.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.13 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|