C30H36IN3O11 — CID 134423213
[(2S,3S,4S,5S,6S)-3,5-diacetyloxy-2-[(S)-acetyloxy(amino)methyl]-2-[iodo(methyl)amino]-6-[2-methyl-4-[3-(methylcarbamoyl)phenyl]phenoxy]oxan-4-yl] acetate (PubChem CID 134423213) has the molecular formula C30H36IN3O11 and a molecular weight of 741.53 g/mol. Its IUPAC name is [(2S,3S,4S,5S,6S)-3,5-diacetyloxy-2-[(S)-acetyloxy(amino)methyl]-2-[iodo(methyl)amino]-6-[2-methyl-4-[3-(methylcarbamoyl)phenyl]phenoxy]oxan-4-yl] acetate.
| Compound Name | [(2S,3S,4S,5S,6S)-3,5-diacetyloxy-2-[(S)-acetyloxy(amino)methyl]-2-[iodo(methyl)amino]-6-[2-methyl-4-[3-(methylcarbamoyl)phenyl]phenoxy]oxan-4-yl] acetate |
|---|---|
| PubChem CID | 134423213 |
| Molecular Formula | C30H36IN3O11 |
| Molecular Weight | 741.53 g/mol |
| Exact Mass | 741.14 |
| IUPAC Name | [(2S,3S,4S,5S,6S)-3,5-diacetyloxy-2-[(S)-acetyloxy(amino)methyl]-2-[iodo(methyl)amino]-6-[2-methyl-4-[3-(methylcarbamoyl)phenyl]phenoxy]oxan-4-yl] acetate |
| SMILES | CNC(=O)c1cccc(-c2ccc(O[C@H]3O[C@@]([C@@H](N)OC(C)=O)(N(C)I)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]3OC(C)=O)c(C)c2)c1 |
| InChI | InChI=1S/C30H36IN3O11/c1-15-13-21(20-9-8-10-22(14-20)27(39)33-6)11-12-23(15)44-28-25(41-17(3)36)24(40-16(2)35)26(42-18(4)37)30(45-28,34(7)31)29(32)43-19(5)38/h8-14,24-26,28-29H,32H2,1-7H3,(H,33,39)/t24-,25+,26+,28+,29+,30+/m1/s1 |
| InChIKey | FMRWAXRHOJYSKW-VGFYBFODSA-N |
| XLogP | 2.38 |
| TPSA | 182.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.53 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|