C30H39NO9 — CID 90441624
[(2R,3S,4S,5R,6R)-3-acetyloxy-6-ethyl-3-(2-hydroxyethoxymethyl)-5-methyl-2-[2-methyl-4-[3-(methylcarbamoyl)phenyl]phenoxy]oxan-4-yl] acetate (PubChem CID 90441624) has the molecular formula C30H39NO9 and a molecular weight of 557.64 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3-acetyloxy-6-ethyl-3-(2-hydroxyethoxymethyl)-5-methyl-2-[2-methyl-4-[3-(methylcarbamoyl)phenyl]phenoxy]oxan-4-yl] acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-3-acetyloxy-6-ethyl-3-(2-hydroxyethoxymethyl)-5-methyl-2-[2-methyl-4-[3-(methylcarbamoyl)phenyl]phenoxy]oxan-4-yl] acetate |
|---|---|
| PubChem CID | 90441624 |
| Molecular Formula | C30H39NO9 |
| Molecular Weight | 557.64 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3-acetyloxy-6-ethyl-3-(2-hydroxyethoxymethyl)-5-methyl-2-[2-methyl-4-[3-(methylcarbamoyl)phenyl]phenoxy]oxan-4-yl] acetate |
| SMILES | CC[C@H]1O[C@H](Oc2ccc(-c3cccc(C(=O)NC)c3)cc2C)[C@@](COCCO)(OC(C)=O)[C@@H](OC(C)=O)[C@@H]1C |
| InChI | InChI=1S/C30H39NO9/c1-7-25-19(3)27(37-20(4)33)30(40-21(5)34,17-36-14-13-32)29(38-25)39-26-12-11-23(15-18(26)2)22-9-8-10-24(16-22)28(35)31-6/h8-12,15-16,19,25,27,29,32H,7,13-14,17H2,1-6H3,(H,31,35)/t19-,25-,27+,29-,30+/m1/s1 |
| InChIKey | IIVVOYOTRIRTFH-CQIVDFSWSA-N |
| XLogP | 3.41 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.64 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|