C30H35NO11 — CID 90402098
2-[(2R,3R,4S,5S,6R)-3,5-diacetyloxy-2-[(1S)-1-acetyloxyethyl]-6-[2-methyl-4-[3-(methylcarbamoyl)phenyl]phenoxy]oxan-4-yl]acetic acid (PubChem CID 90402098) has the molecular formula C30H35NO11 and a molecular weight of 585.61 g/mol. Its IUPAC name is 2-[(2R,3R,4S,5S,6R)-3,5-diacetyloxy-2-[(1S)-1-acetyloxyethyl]-6-[2-methyl-4-[3-(methylcarbamoyl)phenyl]phenoxy]oxan-4-yl]acetic acid.
| Compound Name | 2-[(2R,3R,4S,5S,6R)-3,5-diacetyloxy-2-[(1S)-1-acetyloxyethyl]-6-[2-methyl-4-[3-(methylcarbamoyl)phenyl]phenoxy]oxan-4-yl]acetic acid |
|---|---|
| PubChem CID | 90402098 |
| Molecular Formula | C30H35NO11 |
| Molecular Weight | 585.61 g/mol |
| Exact Mass | 585.22 |
| IUPAC Name | 2-[(2R,3R,4S,5S,6R)-3,5-diacetyloxy-2-[(1S)-1-acetyloxyethyl]-6-[2-methyl-4-[3-(methylcarbamoyl)phenyl]phenoxy]oxan-4-yl]acetic acid |
| SMILES | CNC(=O)c1cccc(-c2ccc(O[C@H]3O[C@H]([C@H](C)OC(C)=O)[C@H](OC(C)=O)[C@H](CC(=O)O)[C@@H]3OC(C)=O)c(C)c2)c1 |
| InChI | InChI=1S/C30H35NO11/c1-15-12-21(20-8-7-9-22(13-20)29(37)31-6)10-11-24(15)41-30-28(40-19(5)34)23(14-25(35)36)27(39-18(4)33)26(42-30)16(2)38-17(3)32/h7-13,16,23,26-28,30H,14H2,1-6H3,(H,31,37)(H,35,36)/t16-,23-,26+,27+,28-,30-/m0/s1 |
| InChIKey | VXSXCQNBYDFSRR-HATYDOCDSA-N |
| XLogP | 3.03 |
| TPSA | 163.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.61 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|