C10H20FN — CID 134441528
(2S)-N,2-diethyl-3-fluorohex-4-en-1-amine (PubChem CID 134441528) has the molecular formula C10H20FN and a molecular weight of 173.27 g/mol. Its IUPAC name is (2S)-N,2-diethyl-3-fluorohex-4-en-1-amine.
| Compound Name | (2S)-N,2-diethyl-3-fluorohex-4-en-1-amine |
|---|---|
| PubChem CID | 134441528 |
| Molecular Formula | C10H20FN |
| Molecular Weight | 173.27 g/mol |
| Exact Mass | 173.16 |
| IUPAC Name | (2S)-N,2-diethyl-3-fluorohex-4-en-1-amine |
| SMILES | CC=CC(F)[C@@H](CC)CNCC |
| InChI | InChI=1S/C10H20FN/c1-4-7-10(11)9(5-2)8-12-6-3/h4,7,9-10,12H,5-6,8H2,1-3H3/t9-,10?/m0/s1 |
| InChIKey | RQSQCGMZXZPPCE-RGURZIINSA-N |
| XLogP | 2.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|