C18H20ClN3O — CID 134447582
(1Z,3Z)-2-[[5-(3-chlorophenyl)-6-methoxy-3-pyridinyl]methyl]penta-1,3-diene-1,4-diamine (PubChem CID 134447582) has the molecular formula C18H20ClN3O and a molecular weight of 329.83 g/mol. Its IUPAC name is (1Z,3Z)-2-[[5-(3-chlorophenyl)-6-methoxy-3-pyridinyl]methyl]penta-1,3-diene-1,4-diamine.
| Compound Name | (1Z,3Z)-2-[[5-(3-chlorophenyl)-6-methoxy-3-pyridinyl]methyl]penta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 134447582 |
| Molecular Formula | C18H20ClN3O |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | (1Z,3Z)-2-[[5-(3-chlorophenyl)-6-methoxy-3-pyridinyl]methyl]penta-1,3-diene-1,4-diamine |
| SMILES | COc1ncc(CC(/C=C(/C)N)=C/N)cc1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H20ClN3O/c1-12(21)6-13(10-20)7-14-8-17(18(23-2)22-11-14)15-4-3-5-16(19)9-15/h3-6,8-11H,7,20-21H2,1-2H3/b12-6-,13-10+ |
| InChIKey | TUVONYAPLDHRNI-DLAMJYEASA-N |
| XLogP | 3.66 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|