C42H48O12 — CID 134453402
2-[4-[4-[2-but-3-en-2-yloxy-3-(4-prop-2-enoyloxybutoxy)propoxy]benzoyl]oxyphenyl]ethyl 4-(3-prop-2-enoyloxypropoxy)benzoate (PubChem CID 134453402) has the molecular formula C42H48O12 and a molecular weight of 744.83 g/mol. Its IUPAC name is 2-[4-[4-[2-but-3-en-2-yloxy-3-(4-prop-2-enoyloxybutoxy)propoxy]benzoyl]oxyphenyl]ethyl 4-(3-prop-2-enoyloxypropoxy)benzoate.
| Compound Name | 2-[4-[4-[2-but-3-en-2-yloxy-3-(4-prop-2-enoyloxybutoxy)propoxy]benzoyl]oxyphenyl]ethyl 4-(3-prop-2-enoyloxypropoxy)benzoate |
|---|---|
| PubChem CID | 134453402 |
| Molecular Formula | C42H48O12 |
| Molecular Weight | 744.83 g/mol |
| Exact Mass | 744.31 |
| IUPAC Name | 2-[4-[4-[2-but-3-en-2-yloxy-3-(4-prop-2-enoyloxybutoxy)propoxy]benzoyl]oxyphenyl]ethyl 4-(3-prop-2-enoyloxypropoxy)benzoate |
| SMILES | C=CC(=O)OCCCCOCC(COc1ccc(C(=O)Oc2ccc(CCOC(=O)c3ccc(OCCCOC(=O)C=C)cc3)cc2)cc1)OC(C)C=C |
| InChI | InChI=1S/C42H48O12/c1-5-31(4)53-38(29-47-24-8-9-25-49-39(43)6-2)30-52-36-21-15-34(16-22-36)42(46)54-37-17-11-32(12-18-37)23-28-51-41(45)33-13-19-35(20-14-33)48-26-10-27-50-40(44)7-3/h5-7,11-22,31,38H,1-3,8-10,23-30H2,4H3 |
| InChIKey | IBKAEKKEUDJYOE-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.83 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|