C14H22N2O2 — CID 134464566
3-methyl-N-(5-methylhexyl)-4-oxo-1H-pyridine-2-carboxamide (PubChem CID 134464566) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 3-methyl-N-(5-methylhexyl)-4-oxo-1H-pyridine-2-carboxamide.
| Compound Name | 3-methyl-N-(5-methylhexyl)-4-oxo-1H-pyridine-2-carboxamide |
|---|---|
| PubChem CID | 134464566 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 3-methyl-N-(5-methylhexyl)-4-oxo-1H-pyridine-2-carboxamide |
| SMILES | Cc1c(C(=O)NCCCCC(C)C)[nH]ccc1=O |
| InChI | InChI=1S/C14H22N2O2/c1-10(2)6-4-5-8-16-14(18)13-11(3)12(17)7-9-15-13/h7,9-10H,4-6,8H2,1-3H3,(H,15,17)(H,16,18) |
| InChIKey | AVVBDRXZJMHUMS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|