C22H33FN4O4 — CID 134470201
2-butoxy-5-fluoro-4-[3-(2-hydroxypropan-2-yl)-4-methyl-5-oxo-1,2,4-triazol-1-yl]-N-pentan-3-ylbenzamide (PubChem CID 134470201) has the molecular formula C22H33FN4O4 and a molecular weight of 436.53 g/mol. Its IUPAC name is 2-butoxy-5-fluoro-4-[3-(2-hydroxypropan-2-yl)-4-methyl-5-oxo-1,2,4-triazol-1-yl]-N-pentan-3-ylbenzamide.
| Compound Name | 2-butoxy-5-fluoro-4-[3-(2-hydroxypropan-2-yl)-4-methyl-5-oxo-1,2,4-triazol-1-yl]-N-pentan-3-ylbenzamide |
|---|---|
| PubChem CID | 134470201 |
| Molecular Formula | C22H33FN4O4 |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | 2-butoxy-5-fluoro-4-[3-(2-hydroxypropan-2-yl)-4-methyl-5-oxo-1,2,4-triazol-1-yl]-N-pentan-3-ylbenzamide |
| SMILES | CCCCOc1cc(-n2nc(C(C)(C)O)n(C)c2=O)c(F)cc1C(=O)NC(CC)CC |
| InChI | InChI=1S/C22H33FN4O4/c1-7-10-11-31-18-13-17(27-21(29)26(6)20(25-27)22(4,5)30)16(23)12-15(18)19(28)24-14(8-2)9-3/h12-14,30H,7-11H2,1-6H3,(H,24,28) |
| InChIKey | TXGWAEXNJCGOHD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 98.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|