C24H28ClF2N3O4 — CID 134475657
4-[[[2-chloro-3-[(3,4-difluorophenyl)methyl]-5-(3-hydroxy-3-methylbut-1-ynyl)-1,2-dihydroimidazole-4-carbonyl]amino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 134475657) has the molecular formula C24H28ClF2N3O4 and a molecular weight of 495.95 g/mol. Its IUPAC name is 4-[[[2-chloro-3-[(3,4-difluorophenyl)methyl]-5-(3-hydroxy-3-methylbut-1-ynyl)-1,2-dihydroimidazole-4-carbonyl]amino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[[2-chloro-3-[(3,4-difluorophenyl)methyl]-5-(3-hydroxy-3-methylbut-1-ynyl)-1,2-dihydroimidazole-4-carbonyl]amino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 134475657 |
| Molecular Formula | C24H28ClF2N3O4 |
| Molecular Weight | 495.95 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | 4-[[[2-chloro-3-[(3,4-difluorophenyl)methyl]-5-(3-hydroxy-3-methylbut-1-ynyl)-1,2-dihydroimidazole-4-carbonyl]amino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | CC(C)(O)C#CC1=C(C(=O)NCC2CCC(C(=O)O)CC2)N(Cc2ccc(F)c(F)c2)C(Cl)N1 |
| InChI | InChI=1S/C24H28ClF2N3O4/c1-24(2,34)10-9-19-20(21(31)28-12-14-3-6-16(7-4-14)22(32)33)30(23(25)29-19)13-15-5-8-17(26)18(27)11-15/h5,8,11,14,16,23,29,34H,3-4,6-7,12-13H2,1-2H3,(H,28,31)(H,32,33) |
| InChIKey | OXWJCPOHMBGLOA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.95 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|