C18H11ClF3N3 — CID 134481360
7-[6-chloro-5-(trifluoromethyl)-3-pyridinyl]-5-methylpyrido[4,3-b]indole (PubChem CID 134481360) has the molecular formula C18H11ClF3N3 and a molecular weight of 361.75 g/mol. Its IUPAC name is 7-[6-chloro-5-(trifluoromethyl)-3-pyridinyl]-5-methylpyrido[4,3-b]indole.
| Compound Name | 7-[6-chloro-5-(trifluoromethyl)-3-pyridinyl]-5-methylpyrido[4,3-b]indole |
|---|---|
| PubChem CID | 134481360 |
| Molecular Formula | C18H11ClF3N3 |
| Molecular Weight | 361.75 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 7-[6-chloro-5-(trifluoromethyl)-3-pyridinyl]-5-methylpyrido[4,3-b]indole |
| SMILES | Cn1c2ccncc2c2ccc(-c3cnc(Cl)c(C(F)(F)F)c3)cc21 |
| InChI | InChI=1S/C18H11ClF3N3/c1-25-15-4-5-23-9-13(15)12-3-2-10(7-16(12)25)11-6-14(18(20,21)22)17(19)24-8-11/h2-9H,1H3 |
| InChIKey | GDPIVEDWMLUKNT-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.75 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|