C11H20O4SSi — CID 13448271
dimethyl 2-trimethylsilylthiolane-3,4-dicarboxylate (PubChem CID 13448271) has the molecular formula C11H20O4SSi and a molecular weight of 276.43 g/mol. Its IUPAC name is dimethyl 2-trimethylsilylthiolane-3,4-dicarboxylate.
| Compound Name | dimethyl 2-trimethylsilylthiolane-3,4-dicarboxylate |
|---|---|
| PubChem CID | 13448271 |
| Molecular Formula | C11H20O4SSi |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | dimethyl 2-trimethylsilylthiolane-3,4-dicarboxylate |
| SMILES | COC(=O)C1CSC([Si](C)(C)C)C1C(=O)OC |
| InChI | InChI=1S/C11H20O4SSi/c1-14-9(12)7-6-16-11(17(3,4)5)8(7)10(13)15-2/h7-8,11H,6H2,1-5H3 |
| InChIKey | OQWKTPLVJDUCPY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|