C11H16N4O5S — CID 134483230
(2S,3S)-3-methyl-2-[(2R)-2-methyl-4-oxoazetidin-1-yl]-3-sulfino-4-(triazol-1-yl)butanoic acid (PubChem CID 134483230) has the molecular formula C11H16N4O5S and a molecular weight of 316.34 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-[(2R)-2-methyl-4-oxoazetidin-1-yl]-3-sulfino-4-(triazol-1-yl)butanoic acid.
| Compound Name | (2S,3S)-3-methyl-2-[(2R)-2-methyl-4-oxoazetidin-1-yl]-3-sulfino-4-(triazol-1-yl)butanoic acid |
|---|---|
| PubChem CID | 134483230 |
| Molecular Formula | C11H16N4O5S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | (2S,3S)-3-methyl-2-[(2R)-2-methyl-4-oxoazetidin-1-yl]-3-sulfino-4-(triazol-1-yl)butanoic acid |
| SMILES | C[C@@H]1CC(=O)N1[C@@H](C(=O)O)[C@](C)(Cn1ccnn1)S(=O)O |
| InChI | InChI=1S/C11H16N4O5S/c1-7-5-8(16)15(7)9(10(17)18)11(2,21(19)20)6-14-4-3-12-13-14/h3-4,7,9H,5-6H2,1-2H3,(H,17,18)(H,19,20)/t7-,9+,11+/m1/s1 |
| InChIKey | MUVBSSFECLJVSO-HDBBIHSSSA-N |
| XLogP | -0.67 |
| TPSA | 125.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|