C10H14N4O5S — CID 6914368
(2S,3S)-3-methyl-2-[[(Z)-3-oxoprop-1-enyl]amino]-3-sulfino-4-(triazol-1-yl)butanoic acid (PubChem CID 6914368) has the molecular formula C10H14N4O5S and a molecular weight of 302.31 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-[[(Z)-3-oxoprop-1-enyl]amino]-3-sulfino-4-(triazol-1-yl)butanoic acid.
| Compound Name | (2S,3S)-3-methyl-2-[[(Z)-3-oxoprop-1-enyl]amino]-3-sulfino-4-(triazol-1-yl)butanoic acid |
|---|---|
| PubChem CID | 6914368 |
| Molecular Formula | C10H14N4O5S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | (2S,3S)-3-methyl-2-[[(Z)-3-oxoprop-1-enyl]amino]-3-sulfino-4-(triazol-1-yl)butanoic acid |
| SMILES | C[C@](Cn1ccnn1)([C@@H](N/C=C\C=O)C(=O)O)S(=O)O |
| InChI | InChI=1S/C10H14N4O5S/c1-10(20(18)19,7-14-5-4-12-13-14)8(9(16)17)11-3-2-6-15/h2-6,8,11H,7H2,1H3,(H,16,17)(H,18,19)/b3-2-/t8-,10-/m0/s1 |
| InChIKey | YGFMROFTTCPCKY-AARLMMRRSA-N |
| XLogP | -0.99 |
| TPSA | 134.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|