C7H12N4O4S — CID 155888287
(3S)-2-amino-3-methyl-3-sulfino-4-(triazol-1-yl)butanoic acid (PubChem CID 155888287) has the molecular formula C7H12N4O4S and a molecular weight of 248.26 g/mol. Its IUPAC name is (3S)-2-amino-3-methyl-3-sulfino-4-(triazol-1-yl)butanoic acid.
| Compound Name | (3S)-2-amino-3-methyl-3-sulfino-4-(triazol-1-yl)butanoic acid |
|---|---|
| PubChem CID | 155888287 |
| Molecular Formula | C7H12N4O4S |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | (3S)-2-amino-3-methyl-3-sulfino-4-(triazol-1-yl)butanoic acid |
| SMILES | C[C@](Cn1ccnn1)(C(N)C(=O)O)S(=O)O |
| InChI | InChI=1S/C7H12N4O4S/c1-7(16(14)15,5(8)6(12)13)4-11-3-2-9-10-11/h2-3,5H,4,8H2,1H3,(H,12,13)(H,14,15)/t5?,7-/m0/s1 |
| InChIKey | HTKDZWPPZOALOH-MSZQBOFLSA-N |
| XLogP | -1.33 |
| TPSA | 131.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|