C10H13N4O5S — CID 46936678
CID 46936678 (PubChem CID 46936678) has the molecular formula C10H13N4O5S and a molecular weight of 301.30 g/mol.
| Compound Name | CID 46936678 |
|---|---|
| PubChem CID | 46936678 |
| Molecular Formula | C10H13N4O5S |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | — |
| SMILES | C[C@](Cn1ccnn1)([C@@H](N/C=C/C=O)C(=O)O)[S](=O)=O |
| InChI | InChI=1S/C10H13N4O5S/c1-10(20(18)19,7-14-5-4-12-13-14)8(9(16)17)11-3-2-6-15/h2-6,8,11H,7H2,1H3,(H,16,17)/b3-2+/t8-,10-/m0/s1 |
| InChIKey | JUNWSLGCXPTCAU-QZWDGIGVSA-N |
| XLogP | -1.33 |
| TPSA | 131.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|