C10H14N4O6S — CID 50904887
(2S,3S)-2-[[(E)-2-carboxyethenyl]amino]-3-methyl-3-sulfino-4-(triazol-1-yl)butanoic acid (PubChem CID 50904887) has the molecular formula C10H14N4O6S and a molecular weight of 318.31 g/mol. Its IUPAC name is (2S,3S)-2-[[(E)-2-carboxyethenyl]amino]-3-methyl-3-sulfino-4-(triazol-1-yl)butanoic acid.
| Compound Name | (2S,3S)-2-[[(E)-2-carboxyethenyl]amino]-3-methyl-3-sulfino-4-(triazol-1-yl)butanoic acid |
|---|---|
| PubChem CID | 50904887 |
| Molecular Formula | C10H14N4O6S |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | (2S,3S)-2-[[(E)-2-carboxyethenyl]amino]-3-methyl-3-sulfino-4-(triazol-1-yl)butanoic acid |
| SMILES | C[C@](Cn1ccnn1)([C@@H](N/C=C/C(=O)O)C(=O)O)S(=O)O |
| InChI | InChI=1S/C10H14N4O6S/c1-10(21(19)20,6-14-5-4-12-13-14)8(9(17)18)11-3-2-7(15)16/h2-5,8,11H,6H2,1H3,(H,15,16)(H,17,18)(H,19,20)/b3-2+/t8-,10-/m0/s1 |
| InChIKey | GHUPJAVAQGJUHD-QZWDGIGVSA-N |
| XLogP | -1.10 |
| TPSA | 154.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|