C15H10F3N3O3S2 — CID 134483287
5-hydroxy-N-[[4-oxo-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-2-ylidene]amino]thiophene-2-carboxamide (PubChem CID 134483287) has the molecular formula C15H10F3N3O3S2 and a molecular weight of 401.39 g/mol. Its IUPAC name is 5-hydroxy-N-[[4-oxo-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-2-ylidene]amino]thiophene-2-carboxamide.
| Compound Name | 5-hydroxy-N-[[4-oxo-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-2-ylidene]amino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 134483287 |
| Molecular Formula | C15H10F3N3O3S2 |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.01 |
| IUPAC Name | 5-hydroxy-N-[[4-oxo-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-2-ylidene]amino]thiophene-2-carboxamide |
| SMILES | O=C(NN=C1SCC(=O)N1c1cccc(C(F)(F)F)c1)c1ccc(O)s1 |
| InChI | InChI=1S/C15H10F3N3O3S2/c16-15(17,18)8-2-1-3-9(6-8)21-11(22)7-25-14(21)20-19-13(24)10-4-5-12(23)26-10/h1-6,23H,7H2,(H,19,24) |
| InChIKey | VAGXLDAZSPVENK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|