C16H9F5N2OS — CID 139220978
3-(2,4-difluorophenyl)-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-4-one (PubChem CID 139220978) has the molecular formula C16H9F5N2OS and a molecular weight of 372.32 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-4-one.
| Compound Name | 3-(2,4-difluorophenyl)-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 139220978 |
| Molecular Formula | C16H9F5N2OS |
| Molecular Weight | 372.32 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 3-(2,4-difluorophenyl)-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-4-one |
| SMILES | O=C1CS/C(=N\c2cccc(C(F)(F)F)c2)N1c1ccc(F)cc1F |
| InChI | InChI=1S/C16H9F5N2OS/c17-10-4-5-13(12(18)7-10)23-14(24)8-25-15(23)22-11-3-1-2-9(6-11)16(19,20)21/h1-7H,8H2/b22-15- |
| InChIKey | HTHXEWCVIRNAHS-JCMHNJIXSA-N |
| XLogP | 4.75 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.32 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|