C19H22ClNO — CID 134483842
2-chloro-4-methyl-3-[(1E)-2-methyl-3-(propylamino)buta-1,3-dienyl]naphthalen-1-ol (PubChem CID 134483842) has the molecular formula C19H22ClNO and a molecular weight of 315.84 g/mol. Its IUPAC name is 2-chloro-4-methyl-3-[(1E)-2-methyl-3-(propylamino)buta-1,3-dienyl]naphthalen-1-ol.
| Compound Name | 2-chloro-4-methyl-3-[(1E)-2-methyl-3-(propylamino)buta-1,3-dienyl]naphthalen-1-ol |
|---|---|
| PubChem CID | 134483842 |
| Molecular Formula | C19H22ClNO |
| Molecular Weight | 315.84 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 2-chloro-4-methyl-3-[(1E)-2-methyl-3-(propylamino)buta-1,3-dienyl]naphthalen-1-ol |
| SMILES | C=C(NCCC)/C(C)=C/c1c(Cl)c(O)c2ccccc2c1C |
| InChI | InChI=1S/C19H22ClNO/c1-5-10-21-14(4)12(2)11-17-13(3)15-8-6-7-9-16(15)19(22)18(17)20/h6-9,11,21-22H,4-5,10H2,1-3H3/b12-11+ |
| InChIKey | QYPYDQUNVQRLRE-VAWYXSNFSA-N |
| XLogP | 5.42 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.84 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|