About 2-chloro-4-methyl-3-[(1E)-2-methyl-3-(propylamino)buta-1,3-dienyl]naphthalen-1-ol
2-chloro-4-methyl-3-[(1E)-2-methyl-3-(propylamino)buta-1,3-dienyl]naphthalen-1-ol (PubChem CID 134483842) has the molecular formula C19H22ClNO
and a molecular weight of 315.84 g/mol. Its IUPAC name is 2-chloro-4-methyl-3-[(1E)-2-methyl-3-(propylamino)buta-1,3-dienyl]naphthalen-1-ol.
Molecular Properties
| Compound Name | 2-chloro-4-methyl-3-[(1E)-2-methyl-3-(propylamino)buta-1,3-dienyl]naphthalen-1-ol |
| PubChem CID | 134483842 |
| Molecular Formula | C19H22ClNO |
| Molecular Weight | 315.84 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 2-chloro-4-methyl-3-[(1E)-2-methyl-3-(propylamino)buta-1,3-dienyl]naphthalen-1-ol |
| SMILES | C=C(NCCC)/C(C)=C/c1c(Cl)c(O)c2ccccc2c1C |
| InChI | InChI=1S/C19H22ClNO/c1-5-10-21-14(4)12(2)11-17-13(3)15-8-6-7-9-16(15)19(22)18(17)20/h6-9,11,21-22H,4-5,10H2,1-3H3/b12-11+ |
| InChIKey | QYPYDQUNVQRLRE-VAWYXSNFSA-N |
| XLogP | 5.42 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 315.84 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-methyl-3-[(1E)-2-methyl-3-(propylamino)buta-1,3-dienyl]naphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-methyl-3-[(1E)-2-methyl-3-(propylamino)buta-1,3-dienyl]naphthalen-1-ol?
The IUPAC name of 2-chloro-4-methyl-3-[(1E)-2-methyl-3-(propylamino)buta-1,3-dienyl]naphthalen-1-ol (CID 134483842) is 2-chloro-4-methyl-3-[(1E)-2-methyl-3-(propylamino)buta-1,3-dienyl]naphthalen-1-ol.
What is the SMILES notation for 2-chloro-4-methyl-3-[(1E)-2-methyl-3-(propylamino)buta-1,3-dienyl]naphthalen-1-ol?
The canonical SMILES for 2-chloro-4-methyl-3-[(1E)-2-methyl-3-(propylamino)buta-1,3-dienyl]naphthalen-1-ol is C=C(NCCC)/C(C)=C/c1c(Cl)c(O)c2ccccc2c1C.
What is the InChIKey of 2-chloro-4-methyl-3-[(1E)-2-methyl-3-(propylamino)buta-1,3-dienyl]naphthalen-1-ol?
The InChIKey is QYPYDQUNVQRLRE-VAWYXSNFSA-N. The full InChI is InChI=1S/C19H22ClNO/c1-5-10-21-14(4)12(2)11-17-13(3)15-8-6-7-9-16(15)19(22)18(17)20/h6-9,11,21-22H,4-5,10H2,1-3H3/b12-11+.
What are the key properties of 2-chloro-4-methyl-3-[(1E)-2-methyl-3-(propylamino)buta-1,3-dienyl]naphthalen-1-ol?
2-chloro-4-methyl-3-[(1E)-2-methyl-3-(propylamino)buta-1,3-dienyl]naphthalen-1-ol has a molecular weight of 315.84 g/mol, XLogP of 5.42, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-methyl-3-[(1E)-2-methyl-3-(propylamino)buta-1,3-dienyl]naphthalen-1-ol is sourced from PubChem (CID 134483842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).