C19H19ClN2O6S — CID 134485236
4-[[4-(4-chlorophenoxy)phenyl]sulfonylmethyl]-N-nitrosooxane-4-carboxamide (PubChem CID 134485236) has the molecular formula C19H19ClN2O6S and a molecular weight of 438.89 g/mol. Its IUPAC name is 4-[[4-(4-chlorophenoxy)phenyl]sulfonylmethyl]-N-nitrosooxane-4-carboxamide.
| Compound Name | 4-[[4-(4-chlorophenoxy)phenyl]sulfonylmethyl]-N-nitrosooxane-4-carboxamide |
|---|---|
| PubChem CID | 134485236 |
| Molecular Formula | C19H19ClN2O6S |
| Molecular Weight | 438.89 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | 4-[[4-(4-chlorophenoxy)phenyl]sulfonylmethyl]-N-nitrosooxane-4-carboxamide |
| SMILES | O=NNC(=O)C1(CS(=O)(=O)c2ccc(Oc3ccc(Cl)cc3)cc2)CCOCC1 |
| InChI | InChI=1S/C19H19ClN2O6S/c20-14-1-3-15(4-2-14)28-16-5-7-17(8-6-16)29(25,26)13-19(18(23)21-22-24)9-11-27-12-10-19/h1-8H,9-13H2,(H,21,23,24) |
| InChIKey | SCHDIWHZURPLGU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.89 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|