C20H20ClNO7S — CID 174403266
[4-[[4-(4-chlorophenoxy)phenyl]sulfonylmethyl]oxane-4-carbonyl]carbamic acid (PubChem CID 174403266) has the molecular formula C20H20ClNO7S and a molecular weight of 453.90 g/mol. Its IUPAC name is [4-[[4-(4-chlorophenoxy)phenyl]sulfonylmethyl]oxane-4-carbonyl]carbamic acid.
| Compound Name | [4-[[4-(4-chlorophenoxy)phenyl]sulfonylmethyl]oxane-4-carbonyl]carbamic acid |
|---|---|
| PubChem CID | 174403266 |
| Molecular Formula | C20H20ClNO7S |
| Molecular Weight | 453.90 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | [4-[[4-(4-chlorophenoxy)phenyl]sulfonylmethyl]oxane-4-carbonyl]carbamic acid |
| SMILES | O=C(O)NC(=O)C1(CS(=O)(=O)c2ccc(Oc3ccc(Cl)cc3)cc2)CCOCC1 |
| InChI | InChI=1S/C20H20ClNO7S/c21-14-1-3-15(4-2-14)29-16-5-7-17(8-6-16)30(26,27)13-20(9-11-28-12-10-20)18(23)22-19(24)25/h1-8H,9-13H2,(H,22,23)(H,24,25) |
| InChIKey | VBGHSRQACVSUFM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.90 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |