C21H33N3 — CID 134485767
N-ethenyl-2-[1-[(2E,4Z)-3-(N-ethenyl-C-methylcarbonimidoyl)hexa-2,4-dien-2-yl]-2-prop-2-enylpyrrolidin-3-yl]ethanamine (PubChem CID 134485767) has the molecular formula C21H33N3 and a molecular weight of 327.52 g/mol. Its IUPAC name is N-ethenyl-2-[1-[(2E,4Z)-3-(N-ethenyl-C-methylcarbonimidoyl)hexa-2,4-dien-2-yl]-2-prop-2-enylpyrrolidin-3-yl]ethanamine.
| Compound Name | N-ethenyl-2-[1-[(2E,4Z)-3-(N-ethenyl-C-methylcarbonimidoyl)hexa-2,4-dien-2-yl]-2-prop-2-enylpyrrolidin-3-yl]ethanamine |
|---|---|
| PubChem CID | 134485767 |
| Molecular Formula | C21H33N3 |
| Molecular Weight | 327.52 g/mol |
| Exact Mass | 327.27 |
| IUPAC Name | N-ethenyl-2-[1-[(2E,4Z)-3-(N-ethenyl-C-methylcarbonimidoyl)hexa-2,4-dien-2-yl]-2-prop-2-enylpyrrolidin-3-yl]ethanamine |
| SMILES | C=CCC1C(CCNC=C)CCN1/C(C)=C(\C=C/C)C(/C)=N/C=C |
| InChI | InChI=1S/C21H33N3/c1-7-11-20(17(5)23-10-4)18(6)24-16-14-19(13-15-22-9-3)21(24)12-8-2/h7-11,19,21-22H,2-4,12-16H2,1,5-6H3/b11-7-,20-18+,23-17+ |
| InChIKey | KKDWYOQTZFZCIC-NUGLLFIOSA-N |
| XLogP | 4.83 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.52 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|