C23H35N3 — CID 145086369
ethane;ethene;(2Z)-2-[5-methyl-2-methylidene-4-[(Z)-prop-1-enyl]-1H-pyrrol-3-ylidene]-3a,7a-dihydro-1H-indol-3-imine (PubChem CID 145086369) has the molecular formula C23H35N3 and a molecular weight of 353.55 g/mol. Its IUPAC name is ethane;ethene;(2Z)-2-[5-methyl-2-methylidene-4-[(Z)-prop-1-enyl]-1H-pyrrol-3-ylidene]-3a,7a-dihydro-1H-indol-3-imine.
| Compound Name | ethane;ethene;(2Z)-2-[5-methyl-2-methylidene-4-[(Z)-prop-1-enyl]-1H-pyrrol-3-ylidene]-3a,7a-dihydro-1H-indol-3-imine |
|---|---|
| PubChem CID | 145086369 |
| Molecular Formula | C23H35N3 |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.28 |
| IUPAC Name | ethane;ethene;(2Z)-2-[5-methyl-2-methylidene-4-[(Z)-prop-1-enyl]-1H-pyrrol-3-ylidene]-3a,7a-dihydro-1H-indol-3-imine |
| SMILES | C=C.CC.CC.[H]/N=C1C(=c2\c(/C=C\C)c(C)[nH]c2=C)/NC2C=CC=CC/12 |
| InChI | InChI=1S/C17H19N3.2C2H6.C2H4/c1-4-7-12-10(2)19-11(3)15(12)17-16(18)13-8-5-6-9-14(13)20-17;3*1-2/h4-9,13-14,18-20H,3H2,1-2H3;2*1-2H3;1-2H2/b7-4-,17-15+,18-16+;;; |
| InChIKey | LPVIAMYAGQEYAC-BHSVPIRUSA-N |
| XLogP | 4.46 |
| TPSA | 51.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|