C11H5BrF2N2 — CID 134489276
7-bromo-8,9-difluoro-5H-pyrido[4,3-b]indole (PubChem CID 134489276) has the molecular formula C11H5BrF2N2 and a molecular weight of 283.08 g/mol. Its IUPAC name is 7-bromo-8,9-difluoro-5H-pyrido[4,3-b]indole.
| Compound Name | 7-bromo-8,9-difluoro-5H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 134489276 |
| Molecular Formula | C11H5BrF2N2 |
| Molecular Weight | 283.08 g/mol |
| Exact Mass | 281.96 |
| IUPAC Name | 7-bromo-8,9-difluoro-5H-pyrido[4,3-b]indole |
| SMILES | Fc1c(Br)cc2[nH]c3ccncc3c2c1F |
| InChI | InChI=1S/C11H5BrF2N2/c12-6-3-8-9(11(14)10(6)13)5-4-15-2-1-7(5)16-8/h1-4,16H |
| InChIKey | ZHPZPXMJSHFCNX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.08 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|