C13H12N2 — CID 91330855
8,9-dimethyl-5H-pyrido[4,3-b]indole (PubChem CID 91330855) has the molecular formula C13H12N2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 8,9-dimethyl-5H-pyrido[4,3-b]indole.
| Compound Name | 8,9-dimethyl-5H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 91330855 |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 8,9-dimethyl-5H-pyrido[4,3-b]indole |
| SMILES | Cc1ccc2[nH]c3ccncc3c2c1C |
| InChI | InChI=1S/C13H12N2/c1-8-3-4-12-13(9(8)2)10-7-14-6-5-11(10)15-12/h3-7,15H,1-2H3 |
| InChIKey | VFHJGTPYYFTKOW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |